C16H31Cl2N3O — CID 119831836
N-(1-ethylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119831836) has the molecular formula C16H31Cl2N3O and a molecular weight of 352.35 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-(1-ethylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119831836 |
| Molecular Formula | C16H31Cl2N3O |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CCN1CCC(NC(=O)C2CC3CCCCC3N2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H29N3O.2ClH/c1-2-19-9-7-13(8-10-19)17-16(20)15-11-12-5-3-4-6-14(12)18-15;;/h12-15,18H,2-11H2,1H3,(H,17,20);2*1H |
| InChIKey | UERBGGYYCYQRAQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |