C16H29ClN2OS — CID 119329950
N-(3-methylsulfanylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119329950) has the molecular formula C16H29ClN2OS and a molecular weight of 332.94 g/mol. Its IUPAC name is N-(3-methylsulfanylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(3-methylsulfanylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119329950 |
| Molecular Formula | C16H29ClN2OS |
| Molecular Weight | 332.94 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(3-methylsulfanylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CSC1CCCC(NC(=O)C2CC3CCCCC3N2)C1.Cl |
| InChI | InChI=1S/C16H28N2OS.ClH/c1-20-13-7-4-6-12(10-13)17-16(19)15-9-11-5-2-3-8-14(11)18-15;/h11-15,18H,2-10H2,1H3,(H,17,19);1H |
| InChIKey | BRDJENVLIHQOJG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |