C10H17ClN2OS — CID 119280432
2-amino-2-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide;hydrochloride (PubChem CID 119280432) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide;hydrochloride.
| Compound Name | 2-amino-2-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119280432 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-amino-2-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide;hydrochloride |
| SMILES | Cc1ccsc1CNC(=O)C(C)(C)N.Cl |
| InChI | InChI=1S/C10H16N2OS.ClH/c1-7-4-5-14-8(7)6-12-9(13)10(2,3)11;/h4-5H,6,11H2,1-3H3,(H,12,13);1H |
| InChIKey | RGTLDRLCVHAGNG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |