C15H19ClN2OS — CID 120588017
2-amino-N-[(3-methylthiophen-2-yl)methyl]-2-phenylpropanamide;hydrochloride (PubChem CID 120588017) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is 2-amino-N-[(3-methylthiophen-2-yl)methyl]-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[(3-methylthiophen-2-yl)methyl]-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120588017 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-amino-N-[(3-methylthiophen-2-yl)methyl]-2-phenylpropanamide;hydrochloride |
| SMILES | Cc1ccsc1CNC(=O)C(C)(N)c1ccccc1.Cl |
| InChI | InChI=1S/C15H18N2OS.ClH/c1-11-8-9-19-13(11)10-17-14(18)15(2,16)12-6-4-3-5-7-12;/h3-9H,10,16H2,1-2H3,(H,17,18);1H |
| InChIKey | VJTMVZALVUHJIU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |