C17H21N3O2S — CID 119282683
N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidine-2-carboxamide (PubChem CID 119282683) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidine-2-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119282683 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidine-2-carboxamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)C3CCCCN3)n2)cc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-2-22-13-8-6-12(7-9-13)15-11-23-17(19-15)20-16(21)14-5-3-4-10-18-14/h6-9,11,14,18H,2-5,10H2,1H3,(H,19,20,21) |
| InChIKey | PFEUITBBBLLAEZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |