C17H21N3O2S2 — CID 119936305
N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119936305) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936305 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)CC3CSCCN3)n2)cc1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-2-22-14-5-3-12(4-6-14)15-11-24-17(19-15)20-16(21)9-13-10-23-8-7-18-13/h3-6,11,13,18H,2,7-10H2,1H3,(H,19,20,21) |
| InChIKey | OHMVUBBVZUMEQG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |