C16H19N3O2S2 — CID 119936390
N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119936390) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936390 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)CC2CSCCN2)n1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-21-14-5-3-2-4-12(14)13-10-23-16(18-13)19-15(20)8-11-9-22-7-6-17-11/h2-5,10-11,17H,6-9H2,1H3,(H,18,19,20) |
| InChIKey | PBLHLHCQGSXZCT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |