C15H16ClN3OS — CID 119676880
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-pyrrolidin-2-ylacetamide (PubChem CID 119676880) has the molecular formula C15H16ClN3OS and a molecular weight of 321.83 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 119676880 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C15H16ClN3OS/c16-12-6-2-1-5-11(12)13-9-21-15(18-13)19-14(20)8-10-4-3-7-17-10/h1-2,5-6,9-10,17H,3-4,7-8H2,(H,18,19,20) |
| InChIKey | WNSGGKAFNXHLHT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |