C13H21N3OS — CID 54960004
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-pyrrolidin-2-ylacetamide (PubChem CID 54960004) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 54960004 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-pyrrolidin-2-ylacetamide |
| SMILES | CC(C)(C)c1csc(NC(=O)CC2CCCN2)n1 |
| InChI | InChI=1S/C13H21N3OS/c1-13(2,3)10-8-18-12(15-10)16-11(17)7-9-5-4-6-14-9/h8-9,14H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | ZKOKWOKKLLULGR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |