C15H16ClN3OS2 — CID 119935123
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119935123) has the molecular formula C15H16ClN3OS2 and a molecular weight of 353.90 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935123 |
| Molecular Formula | C15H16ClN3OS2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C15H16ClN3OS2/c16-12-4-2-1-3-11(12)13-9-22-15(18-13)19-14(20)7-10-8-21-6-5-17-10/h1-4,9-10,17H,5-8H2,(H,18,19,20) |
| InChIKey | JTTHKYWNKMCMCW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |