C18H26ClN3O2 — CID 119290019
1-amino-N-[3-(2-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119290019) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-amino-N-[3-(2-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[3-(2-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119290019 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-amino-N-[3-(2-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)Nc2cccc(N3CCCCC3=O)c2)CCCCC1 |
| InChI | InChI=1S/C18H25N3O2.ClH/c19-18(10-3-1-4-11-18)17(23)20-14-7-6-8-15(13-14)21-12-5-2-9-16(21)22;/h6-8,13H,1-5,9-12,19H2,(H,20,23);1H |
| InChIKey | PQBUVLLDTBHZLI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |