C16H25Cl2N3O — CID 119857471
1-amino-N-(3-pyrrolidin-1-ylphenyl)cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119857471) has the molecular formula C16H25Cl2N3O and a molecular weight of 346.30 g/mol. Its IUPAC name is 1-amino-N-(3-pyrrolidin-1-ylphenyl)cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-(3-pyrrolidin-1-ylphenyl)cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119857471 |
| Molecular Formula | C16H25Cl2N3O |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-amino-N-(3-pyrrolidin-1-ylphenyl)cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)Nc2cccc(N3CCCC3)c2)CCCC1 |
| InChI | InChI=1S/C16H23N3O.2ClH/c17-16(8-1-2-9-16)15(20)18-13-6-5-7-14(12-13)19-10-3-4-11-19;;/h5-7,12H,1-4,8-11,17H2,(H,18,20);2*1H |
| InChIKey | ZPVXELZRGXLQAF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |