C19H26N2O3 — CID 119290976
methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-3-phenylpropanoate (PubChem CID 119290976) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 119290976 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C19H26N2O3/c1-24-19(23)17(11-13-7-3-2-4-8-13)21-18(22)16-12-14-9-5-6-10-15(14)20-16/h2-4,7-8,14-17,20H,5-6,9-12H2,1H3,(H,21,22) |
| InChIKey | NQVGAQXAZGAMBJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |