C21H25FN2O — CID 119293561
(2S)-2-amino-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-phenylpropanamide (PubChem CID 119293561) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119293561 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2S)-2-amino-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCC1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C21H25FN2O/c22-18-10-8-17(9-11-18)21(12-4-5-13-21)15-24-20(25)19(23)14-16-6-2-1-3-7-16/h1-3,6-11,19H,4-5,12-15,23H2,(H,24,25)/t19-/m0/s1 |
| InChIKey | IUJYWOCSWZYDJB-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |