C20H28F3N3O2 — CID 11929401
(2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propanamide (PubChem CID 11929401) has the molecular formula C20H28F3N3O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propanamide.
| Compound Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 11929401 |
| Molecular Formula | C20H28F3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@H](C)N(C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H28F3N3O2/c1-11-6-5-7-15(12(11)2)25-20(28)13(3)26(4)10-17(27)24-16-9-8-14(21)18(22)19(16)23/h8-9,11-13,15H,5-7,10H2,1-4H3,(H,24,27)(H,25,28)/t11-,12-,13-,15+/m1/s1 |
| InChIKey | GACCXKCIVIBOSU-BHPKHCPMSA-N |
| XLogP | 3.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|