About (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide
(2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide (PubChem CID 119295189) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide |
| PubChem CID | 119295189 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NC1COc2ccccc2C1 |
| InChI | InChI=1S/C14H20N2O2S/c1-19-7-6-12(15)14(17)16-11-8-10-4-2-3-5-13(10)18-9-11/h2-5,11-12H,6-9,15H2,1H3,(H,16,17)/t11?,12-/m0/s1 |
| InChIKey | OVAMTVZQBNIFKL-KIYNQFGBSA-N |
| XLogP | 1.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide?
The IUPAC name of (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide (CID 119295189) is (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide.
What is the SMILES notation for (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide?
The canonical SMILES for (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide is CSCC[C@H](N)C(=O)NC1COc2ccccc2C1.
What is the InChIKey of (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide?
The InChIKey is OVAMTVZQBNIFKL-KIYNQFGBSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-19-7-6-12(15)14(17)16-11-8-10-4-2-3-5-13(10)18-9-11/h2-5,11-12H,6-9,15H2,1H3,(H,16,17)/t11?,12-/m0/s1.
What are the key properties of (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide?
(2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide has a molecular weight of 280.39 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-(3,4-dihydro-2H-chromen-3-yl)-4-methylsulfanylbutanamide is sourced from PubChem (CID 119295189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).