C16H26ClN3O4S — CID 119296365
4-amino-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]butanamide;hydrochloride (PubChem CID 119296365) has the molecular formula C16H26ClN3O4S and a molecular weight of 391.92 g/mol. Its IUPAC name is 4-amino-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119296365 |
| Molecular Formula | C16H26ClN3O4S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-amino-N-[[4-(oxolan-2-ylmethylsulfamoyl)phenyl]methyl]butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)NCc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H25N3O4S.ClH/c17-9-1-4-16(20)18-11-13-5-7-15(8-6-13)24(21,22)19-12-14-3-2-10-23-14;/h5-8,14,19H,1-4,9-12,17H2,(H,18,20);1H |
| InChIKey | CVNYNPXCDZXQAF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |