C21H30N3O3S+ — CID 11930090
ethyl 2-[(1R)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]ethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 11930090) has the molecular formula C21H30N3O3S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is ethyl 2-[(1R)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]ethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[(1R)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]ethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 11930090 |
| Molecular Formula | C21H30N3O3S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | ethyl 2-[(1R)-1-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]ethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc([C@@H](C)[NH+]3CC[C@@H]4CCCC[C@@H]4C3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C21H29N3O3S/c1-4-27-21(26)17-12(2)16-19(25)22-18(23-20(16)28-17)13(3)24-10-9-14-7-5-6-8-15(14)11-24/h13-15H,4-11H2,1-3H3,(H,22,23,25)/p+1/t13-,14+,15-/m1/s1 |
| InChIKey | MDAQNOIQPUHMCC-QLFBSQMISA-O |
| XLogP | 2.63 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |