C13H21N3O3S — CID 119307081
2-amino-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide (PubChem CID 119307081) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-amino-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 119307081 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-amino-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)CN |
| InChI | InChI=1S/C13H21N3O3S/c1-10(2)16-20(18,19)9-12-6-4-3-5-11(12)8-15-13(17)7-14/h3-6,10,16H,7-9,14H2,1-2H3,(H,15,17) |
| InChIKey | UJEAEFGCXHPEIM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |