C22H25N3O3S — CID 24616463
1-naphthalen-1-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea (PubChem CID 24616463) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-naphthalen-1-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea.
| Compound Name | 1-naphthalen-1-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 24616463 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-naphthalen-1-yl-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]urea |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H25N3O3S/c1-16(2)25-29(27,28)15-19-10-4-3-9-18(19)14-23-22(26)24-21-13-7-11-17-8-5-6-12-20(17)21/h3-13,16,25H,14-15H2,1-2H3,(H2,23,24,26) |
| InChIKey | HHXPRVRDSLPXES-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |