C10H13IN2O2 — CID 119307883
3-amino-N-(2-iodo-5-methoxyphenyl)propanamide (PubChem CID 119307883) has the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. Its IUPAC name is 3-amino-N-(2-iodo-5-methoxyphenyl)propanamide.
| Compound Name | 3-amino-N-(2-iodo-5-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 119307883 |
| Molecular Formula | C10H13IN2O2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 3-amino-N-(2-iodo-5-methoxyphenyl)propanamide |
| SMILES | COc1ccc(I)c(NC(=O)CCN)c1 |
| InChI | InChI=1S/C10H13IN2O2/c1-15-7-2-3-8(11)9(6-7)13-10(14)4-5-12/h2-3,6H,4-5,12H2,1H3,(H,13,14) |
| InChIKey | ZXMPPFFJAJGTQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|