C10H14ClIN2O2 — CID 119756577
N-(2-iodo-5-methoxyphenyl)-2-(methylamino)acetamide;hydrochloride (PubChem CID 119756577) has the molecular formula C10H14ClIN2O2 and a molecular weight of 356.59 g/mol. Its IUPAC name is N-(2-iodo-5-methoxyphenyl)-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-(2-iodo-5-methoxyphenyl)-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119756577 |
| Molecular Formula | C10H14ClIN2O2 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | N-(2-iodo-5-methoxyphenyl)-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1cc(OC)ccc1I.Cl |
| InChI | InChI=1S/C10H13IN2O2.ClH/c1-12-6-10(14)13-9-5-7(15-2)3-4-8(9)11;/h3-5,12H,6H2,1-2H3,(H,13,14);1H |
| InChIKey | UHOBKDXIQHMDCK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|