C19H29ClN2O — CID 119308533
[2-(1-phenylpropyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride (PubChem CID 119308533) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is [2-(1-phenylpropyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride.
| Compound Name | [2-(1-phenylpropyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119308533 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [2-(1-phenylpropyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride |
| SMILES | CCC(c1ccccc1)C1CCCN1C(=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C19H28N2O.ClH/c1-2-17(15-8-4-3-5-9-15)18-11-7-13-21(18)19(22)16-10-6-12-20-14-16;/h3-5,8-9,16-18,20H,2,6-7,10-14H2,1H3;1H |
| InChIKey | OGPVEOYNGSXSRV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |