C11H24ClN3O2 — CID 119312465
2-(2-aminopentanoylamino)-2-ethylbutanamide;hydrochloride (PubChem CID 119312465) has the molecular formula C11H24ClN3O2 and a molecular weight of 265.78 g/mol. Its IUPAC name is 2-(2-aminopentanoylamino)-2-ethylbutanamide;hydrochloride.
| Compound Name | 2-(2-aminopentanoylamino)-2-ethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119312465 |
| Molecular Formula | C11H24ClN3O2 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-(2-aminopentanoylamino)-2-ethylbutanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)NC(CC)(CC)C(N)=O.Cl |
| InChI | InChI=1S/C11H23N3O2.ClH/c1-4-7-8(12)9(15)14-11(5-2,6-3)10(13)16;/h8H,4-7,12H2,1-3H3,(H2,13,16)(H,14,15);1H |
| InChIKey | LFCXDCNMUDZJMN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |