C11H19ClN4O2 — CID 119314318
N-[1-(2-methoxyethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119314318) has the molecular formula C11H19ClN4O2 and a molecular weight of 274.75 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[1-(2-methoxyethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119314318 |
| Molecular Formula | C11H19ClN4O2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[1-(2-methoxyethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | COCCn1ccc(NC(=O)C2CCCN2)n1.Cl |
| InChI | InChI=1S/C11H18N4O2.ClH/c1-17-8-7-15-6-4-10(14-15)13-11(16)9-3-2-5-12-9;/h4,6,9,12H,2-3,5,7-8H2,1H3,(H,13,14,16);1H |
| InChIKey | OEGJDZWXEYJTFJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |