C16H23Cl2N5O — CID 119871304
(2R)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]piperidine-2-carboxamide;dihydrochloride (PubChem CID 119871304) has the molecular formula C16H23Cl2N5O and a molecular weight of 372.30 g/mol. Its IUPAC name is (2R)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]piperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2R)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119871304 |
| Molecular Formula | C16H23Cl2N5O |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (2R)-N-[1-(2-pyridin-4-ylethyl)pyrazol-3-yl]piperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccn(CCc2ccncc2)n1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C16H21N5O.2ClH/c22-16(14-3-1-2-8-18-14)19-15-7-12-21(20-15)11-6-13-4-9-17-10-5-13;;/h4-5,7,9-10,12,14,18H,1-3,6,8,11H2,(H,19,20,22);2*1H/t14-;;/m1../s1 |
| InChIKey | IKQWXCHOWCWTKC-FMOMHUKBSA-N |
| XLogP | 2.44 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |