C15H29ClN2OS — CID 119315111
(2S)-2-amino-1-(3-azaspiro[5.5]undecan-3-yl)-4-methylsulfanylbutan-1-one;hydrochloride (PubChem CID 119315111) has the molecular formula C15H29ClN2OS and a molecular weight of 320.93 g/mol. Its IUPAC name is (2S)-2-amino-1-(3-azaspiro[5.5]undecan-3-yl)-4-methylsulfanylbutan-1-one;hydrochloride.
| Compound Name | (2S)-2-amino-1-(3-azaspiro[5.5]undecan-3-yl)-4-methylsulfanylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119315111 |
| Molecular Formula | C15H29ClN2OS |
| Molecular Weight | 320.93 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2S)-2-amino-1-(3-azaspiro[5.5]undecan-3-yl)-4-methylsulfanylbutan-1-one;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)N1CCC2(CCCCC2)CC1.Cl |
| InChI | InChI=1S/C15H28N2OS.ClH/c1-19-12-5-13(16)14(18)17-10-8-15(9-11-17)6-3-2-4-7-15;/h13H,2-12,16H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | IWKAQKLLSPOPLG-ZOWNYOTGSA-N |
| XLogP | 3.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |