C23H34N3O3S+ — CID 11931519
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]ethanone (PubChem CID 11931519) has the molecular formula C23H34N3O3S+ and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 11931519 |
| Molecular Formula | C23H34N3O3S+ |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(C[NH+]1CCC[C@H]2CCCC[C@@H]21)N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N3O3S/c27-23(19-25-13-6-10-21-9-4-5-11-22(21)25)24-14-16-26(17-15-24)30(28,29)18-12-20-7-2-1-3-8-20/h1-3,7-8,12,18,21-22H,4-6,9-11,13-17,19H2/p+1/b18-12+/t21-,22+/m1/s1 |
| InChIKey | APLXPMQVVWMNNK-KZSGTBTDSA-O |
| XLogP | 1.37 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |