C18H28ClN3O3S — CID 119316345
N-[1-[3-(methylsulfamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119316345) has the molecular formula C18H28ClN3O3S and a molecular weight of 401.96 g/mol. Its IUPAC name is N-[1-[3-(methylsulfamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[1-[3-(methylsulfamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119316345 |
| Molecular Formula | C18H28ClN3O3S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[1-[3-(methylsulfamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1cccc(C(C)NC(=O)C2CC3CCCCC3N2)c1.Cl |
| InChI | InChI=1S/C18H27N3O3S.ClH/c1-12(13-7-5-8-15(10-13)25(23,24)19-2)20-18(22)17-11-14-6-3-4-9-16(14)21-17;/h5,7-8,10,12,14,16-17,19,21H,3-4,6,9,11H2,1-2H3,(H,20,22);1H |
| InChIKey | SMOJNUGRLOCWCE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |