C17H23ClN2O — CID 81370211
N-[(1S)-1-(3-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 81370211) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 81370211 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | C[C@H](NC(=O)C1CC2CCCCC2N1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2O/c1-11(12-6-4-7-14(18)9-12)19-17(21)16-10-13-5-2-3-8-15(13)20-16/h4,6-7,9,11,13,15-16,20H,2-3,5,8,10H2,1H3,(H,19,21)/t11-,13?,15?,16?/m0/s1 |
| InChIKey | IQJTVQGVPBSDAI-VHBBEVCXSA-N |
| XLogP | 3.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |