C22H17Cl2N5O3S — CID 1193181
2-N-(3,5-dichlorophenyl)-3-N-(3,4-dimethylphenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide (PubChem CID 1193181) has the molecular formula C22H17Cl2N5O3S and a molecular weight of 502.38 g/mol. Its IUPAC name is 2-N-(3,5-dichlorophenyl)-3-N-(3,4-dimethylphenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide.
| Compound Name | 2-N-(3,5-dichlorophenyl)-3-N-(3,4-dimethylphenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 1193181 |
| Molecular Formula | C22H17Cl2N5O3S |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 2-N-(3,5-dichlorophenyl)-3-N-(3,4-dimethylphenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(C(=O)Nc3cc(Cl)cc(Cl)c3)sc3nc(=O)c(C)nn23)cc1C |
| InChI | InChI=1S/C22H17Cl2N5O3S/c1-10-4-5-15(6-11(10)2)25-20(31)17-18(33-22-27-19(30)12(3)28-29(17)22)21(32)26-16-8-13(23)7-14(24)9-16/h4-9H,1-3H3,(H,25,31)(H,26,32) |
| InChIKey | SHGQYHMCVNIUNY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |