C21H14Cl3N5O3S — CID 1184190
3-N-(4-chloro-2-methylphenyl)-2-N-(3,5-dichlorophenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide (PubChem CID 1184190) has the molecular formula C21H14Cl3N5O3S and a molecular weight of 522.80 g/mol. Its IUPAC name is 3-N-(4-chloro-2-methylphenyl)-2-N-(3,5-dichlorophenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide.
| Compound Name | 3-N-(4-chloro-2-methylphenyl)-2-N-(3,5-dichlorophenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 1184190 |
| Molecular Formula | C21H14Cl3N5O3S |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | 3-N-(4-chloro-2-methylphenyl)-2-N-(3,5-dichlorophenyl)-6-methyl-7-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazine-2,3-dicarboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1c(C(=O)Nc2cc(Cl)cc(Cl)c2)sc2nc(=O)c(C)nn12 |
| InChI | InChI=1S/C21H14Cl3N5O3S/c1-9-5-11(22)3-4-15(9)26-19(31)16-17(33-21-27-18(30)10(2)28-29(16)21)20(32)25-14-7-12(23)6-13(24)8-14/h3-8H,1-2H3,(H,25,32)(H,26,31) |
| InChIKey | IBIHMCLYEIESPK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |