C15H25ClN2O — CID 119318689
4-amino-N-[2-methyl-2-(4-methylphenyl)propyl]butanamide;hydrochloride (PubChem CID 119318689) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 4-amino-N-[2-methyl-2-(4-methylphenyl)propyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-methyl-2-(4-methylphenyl)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119318689 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-amino-N-[2-methyl-2-(4-methylphenyl)propyl]butanamide;hydrochloride |
| SMILES | Cc1ccc(C(C)(C)CNC(=O)CCCN)cc1.Cl |
| InChI | InChI=1S/C15H24N2O.ClH/c1-12-6-8-13(9-7-12)15(2,3)11-17-14(18)5-4-10-16;/h6-9H,4-5,10-11,16H2,1-3H3,(H,17,18);1H |
| InChIKey | PLCMLBYVCKUDBY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |