C12H17N2ORu — CID 142973882
[2-methyl-2-(4-methylphenyl)propyl]carbamoylazanide;ruthenium(1+) (PubChem CID 142973882) has the molecular formula C12H17N2ORu and a molecular weight of 306.35 g/mol. Its IUPAC name is [2-methyl-2-(4-methylphenyl)propyl]carbamoylazanide;ruthenium(1+).
| Compound Name | [2-methyl-2-(4-methylphenyl)propyl]carbamoylazanide;ruthenium(1+) |
|---|---|
| PubChem CID | 142973882 |
| Molecular Formula | C12H17N2ORu |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | [2-methyl-2-(4-methylphenyl)propyl]carbamoylazanide;ruthenium(1+) |
| SMILES | Cc1ccc(C(C)(C)CNC([NH-])=O)cc1.[Ru+] |
| InChI | InChI=1S/C12H18N2O.Ru/c1-9-4-6-10(7-5-9)12(2,3)8-14-11(13)15;/h4-7H,8H2,1-3H3,(H3,13,14,15);/q;+1/p-1 |
| InChIKey | GWYXFVCCYMZEDC-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |