C17H21N3OS — CID 119320857
N-[1-(4-phenyl-1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide (PubChem CID 119320857) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[1-(4-phenyl-1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide.
| Compound Name | N-[1-(4-phenyl-1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119320857 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[1-(4-phenyl-1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCCCN1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H21N3OS/c1-12(19-16(21)14-9-5-6-10-18-14)17-20-15(11-22-17)13-7-3-2-4-8-13/h2-4,7-8,11-12,14,18H,5-6,9-10H2,1H3,(H,19,21) |
| InChIKey | NYQAIOWJFUXYGV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |