C17H29ClN2OS — CID 119322592
(2S)-2-amino-4-methylsulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]butanamide;hydrochloride (PubChem CID 119322592) has the molecular formula C17H29ClN2OS and a molecular weight of 344.95 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119322592 |
| Molecular Formula | C17H29ClN2OS |
| Molecular Weight | 344.95 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[3-(4-propan-2-ylphenyl)propyl]butanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)NCCCc1ccc(C(C)C)cc1.Cl |
| InChI | InChI=1S/C17H28N2OS.ClH/c1-13(2)15-8-6-14(7-9-15)5-4-11-19-17(20)16(18)10-12-21-3;/h6-9,13,16H,4-5,10-12,18H2,1-3H3,(H,19,20);1H/t16-;/m0./s1 |
| InChIKey | YVXZKAKGRSICLW-NTISSMGPSA-N |
| XLogP | 3.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|