C21H27ClN2O3S — CID 119324202
2-amino-N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-phenylacetamide;hydrochloride (PubChem CID 119324202) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is 2-amino-N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-phenylacetamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119324202 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-amino-N-[3-(cyclohexylsulfonylmethyl)phenyl]-2-phenylacetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)Nc1cccc(CS(=O)(=O)C2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S.ClH/c22-20(17-9-3-1-4-10-17)21(24)23-18-11-7-8-16(14-18)15-27(25,26)19-12-5-2-6-13-19;/h1,3-4,7-11,14,19-20H,2,5-6,12-13,15,22H2,(H,23,24);1H |
| InChIKey | GWCYPOJCIDLBFY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |