C21H30N2O4S — CID 86940159
N-[2-[3-(cyclohexylsulfonylmethyl)anilino]-2-oxoethyl]cyclopentanecarboxamide (PubChem CID 86940159) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[2-[3-(cyclohexylsulfonylmethyl)anilino]-2-oxoethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[3-(cyclohexylsulfonylmethyl)anilino]-2-oxoethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 86940159 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[2-[3-(cyclohexylsulfonylmethyl)anilino]-2-oxoethyl]cyclopentanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCC1)Nc1cccc(CS(=O)(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H30N2O4S/c24-20(14-22-21(25)17-8-4-5-9-17)23-18-10-6-7-16(13-18)15-28(26,27)19-11-2-1-3-12-19/h6-7,10,13,17,19H,1-5,8-9,11-12,14-15H2,(H,22,25)(H,23,24) |
| InChIKey | HCIUVUOWTOBKPN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |