C16H23FN2O3 — CID 119324627
N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]piperidine-2-carboxamide (PubChem CID 119324627) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]piperidine-2-carboxamide.
| Compound Name | N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119324627 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]piperidine-2-carboxamide |
| SMILES | COc1cc(F)c(C(C)NC(=O)C2CCCCN2)cc1OC |
| InChI | InChI=1S/C16H23FN2O3/c1-10(19-16(20)13-6-4-5-7-18-13)11-8-14(21-2)15(22-3)9-12(11)17/h8-10,13,18H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | DAANGXNXWHUGMR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |