C14H18F2N2O — CID 103808929
(2R)-N-[1-(2,5-difluorophenyl)ethyl]piperidine-2-carboxamide (PubChem CID 103808929) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is (2R)-N-[1-(2,5-difluorophenyl)ethyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-[1-(2,5-difluorophenyl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 103808929 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2R)-N-[1-(2,5-difluorophenyl)ethyl]piperidine-2-carboxamide |
| SMILES | CC(NC(=O)[C@H]1CCCCN1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H18F2N2O/c1-9(11-8-10(15)5-6-12(11)16)18-14(19)13-4-2-3-7-17-13/h5-6,8-9,13,17H,2-4,7H2,1H3,(H,18,19)/t9?,13-/m1/s1 |
| InChIKey | XVTNCKBLUXLPMI-WCRCJTMVSA-N |
| XLogP | 2.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |