C16H22F2N2O — CID 64562272
N-[1-(2,5-difluorophenyl)ethyl]-N-methylazepane-2-carboxamide (PubChem CID 64562272) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-N-methylazepane-2-carboxamide.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-N-methylazepane-2-carboxamide |
|---|---|
| PubChem CID | 64562272 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-N-methylazepane-2-carboxamide |
| SMILES | CC(c1cc(F)ccc1F)N(C)C(=O)C1CCCCCN1 |
| InChI | InChI=1S/C16H22F2N2O/c1-11(13-10-12(17)7-8-14(13)18)20(2)16(21)15-6-4-3-5-9-19-15/h7-8,10-11,15,19H,3-6,9H2,1-2H3 |
| InChIKey | GATCGSBLDUXPNS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |