C18H31ClN2O — CID 119325324
4-(aminomethyl)-N-(2,2,6-trimethylheptan-3-yl)benzamide;hydrochloride (PubChem CID 119325324) has the molecular formula C18H31ClN2O and a molecular weight of 326.91 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,2,6-trimethylheptan-3-yl)benzamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-(2,2,6-trimethylheptan-3-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119325324 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 4-(aminomethyl)-N-(2,2,6-trimethylheptan-3-yl)benzamide;hydrochloride |
| SMILES | CC(C)CCC(NC(=O)c1ccc(CN)cc1)C(C)(C)C.Cl |
| InChI | InChI=1S/C18H30N2O.ClH/c1-13(2)6-11-16(18(3,4)5)20-17(21)15-9-7-14(12-19)8-10-15;/h7-10,13,16H,6,11-12,19H2,1-5H3,(H,20,21);1H |
| InChIKey | KLJHAGZRVUSTFL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |