C21H29N3O2S2 — CID 11933237
(2R)-N-[(1R,2S)-2-methylcyclohexyl]-2-[[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide (PubChem CID 11933237) has the molecular formula C21H29N3O2S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is (2R)-N-[(1R,2S)-2-methylcyclohexyl]-2-[[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1R,2S)-2-methylcyclohexyl]-2-[[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 11933237 |
| Molecular Formula | C21H29N3O2S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2R)-N-[(1R,2S)-2-methylcyclohexyl]-2-[[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide |
| SMILES | C[C@H]1CCc2c(sc3nc(S[C@H](C)C(=O)N[C@@H]4CCCC[C@@H]4C)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C21H29N3O2S2/c1-11-8-9-14-16(10-11)28-20-17(14)19(26)23-21(24-20)27-13(3)18(25)22-15-7-5-4-6-12(15)2/h11-13,15H,4-10H2,1-3H3,(H,22,25)(H,23,24,26)/t11-,12-,13+,15+/m0/s1 |
| InChIKey | WBSKCASLDNIMKK-RMRHIDDWSA-N |
| XLogP | 4.28 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |