C24H29N3O2S2 — CID 23409921
N-(2,6-diethylphenyl)-2-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 23409921) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 23409921 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C)Sc1nc2sc3c(c2c(=O)[nH]1)CCC(C)C3 |
| InChI | InChI=1S/C24H29N3O2S2/c1-5-15-8-7-9-16(6-2)20(15)25-21(28)14(4)30-24-26-22(29)19-17-11-10-13(3)12-18(17)31-23(19)27-24/h7-9,13-14H,5-6,10-12H2,1-4H3,(H,25,28)(H,26,27,29) |
| InChIKey | MYMONMILHBYDCK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |