C23H28N4O2S — CID 7746872
(2S)-N-(2,6-diethylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide (PubChem CID 7746872) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is (2S)-N-(2,6-diethylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide.
| Compound Name | (2S)-N-(2,6-diethylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide |
|---|---|
| PubChem CID | 7746872 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (2S)-N-(2,6-diethylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)[C@H](C)n1nnc2sc3c(c2c1=O)CC[C@@H](C)C3 |
| InChI | InChI=1S/C23H28N4O2S/c1-5-15-8-7-9-16(6-2)20(15)24-21(28)14(4)27-23(29)19-17-11-10-13(3)12-18(17)30-22(19)25-26-27/h7-9,13-14H,5-6,10-12H2,1-4H3,(H,24,28)/t13-,14+/m1/s1 |
| InChIKey | WMMYSKFYKQFEIE-KGLIPLIRSA-N |
| XLogP | 4.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |