C21H24N4O2S — CID 7746925
(2S)-N-(2,5-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide (PubChem CID 7746925) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide.
| Compound Name | (2S)-N-(2,5-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide |
|---|---|
| PubChem CID | 7746925 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (2S)-N-(2,5-dimethylphenyl)-2-[(7S)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl]propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](C)n2nnc3sc4c(c3c2=O)CC[C@H](C)C4)c1 |
| InChI | InChI=1S/C21H24N4O2S/c1-11-5-7-13(3)16(9-11)22-19(26)14(4)25-21(27)18-15-8-6-12(2)10-17(15)28-20(18)23-24-25/h5,7,9,12,14H,6,8,10H2,1-4H3,(H,22,26)/t12-,14-/m0/s1 |
| InChIKey | LYFDGFIVDDYSRE-JSGCOSHPSA-N |
| XLogP | 3.79 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |