C22H26N4O2S — CID 44641163
2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 44641163) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 44641163 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)n2nnc3sc4c(c3c2=O)CCC(C)C4)c(C)c1 |
| InChI | InChI=1S/C22H26N4O2S/c1-11-6-7-16-17(10-11)29-21-18(16)22(28)26(25-24-21)15(5)20(27)23-19-13(3)8-12(2)9-14(19)4/h8-9,11,15H,6-7,10H2,1-5H3,(H,23,27) |
| InChIKey | HYYWSFBOAAEGLC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |