C16H31ClN2O3 — CID 119332945
1-amino-N-[3-(oxan-4-ylmethoxy)propyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119332945) has the molecular formula C16H31ClN2O3 and a molecular weight of 334.89 g/mol. Its IUPAC name is 1-amino-N-[3-(oxan-4-ylmethoxy)propyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[3-(oxan-4-ylmethoxy)propyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119332945 |
| Molecular Formula | C16H31ClN2O3 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-amino-N-[3-(oxan-4-ylmethoxy)propyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NCCCOCC2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C16H30N2O3.ClH/c17-16(7-2-1-3-8-16)15(19)18-9-4-10-21-13-14-5-11-20-12-6-14;/h14H,1-13,17H2,(H,18,19);1H |
| InChIKey | LLYPMYLYMZINKF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|