C17H31ClN2O3 — CID 119799999
3-amino-N-[3-(oxan-4-ylmethoxy)propyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119799999) has the molecular formula C17H31ClN2O3 and a molecular weight of 346.90 g/mol. Its IUPAC name is 3-amino-N-[3-(oxan-4-ylmethoxy)propyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[3-(oxan-4-ylmethoxy)propyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119799999 |
| Molecular Formula | C17H31ClN2O3 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-amino-N-[3-(oxan-4-ylmethoxy)propyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1C2CCC(C2)C1C(=O)NCCCOCC1CCOCC1 |
| InChI | InChI=1S/C17H30N2O3.ClH/c18-16-14-3-2-13(10-14)15(16)17(20)19-6-1-7-22-11-12-4-8-21-9-5-12;/h12-16H,1-11,18H2,(H,19,20);1H |
| InChIKey | VLICCYQLQPZYAM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|