C13H22N2O5 — CID 95635226
cis-(1S,2R)-2-nitro-N-[3-(oxan-4-ylmethoxy)propyl]cyclopropane-1-carboxamide (PubChem CID 95635226) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is cis-(1S,2R)-2-nitro-N-[3-(oxan-4-ylmethoxy)propyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-nitro-N-[3-(oxan-4-ylmethoxy)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95635226 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | cis-(1S,2R)-2-nitro-N-[3-(oxan-4-ylmethoxy)propyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCOCC1CCOCC1)[C@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C13H22N2O5/c16-13(11-8-12(11)15(17)18)14-4-1-5-20-9-10-2-6-19-7-3-10/h10-12H,1-9H2,(H,14,16)/t11-,12+/m0/s1 |
| InChIKey | BJYVUWVRYDWEOP-NWDGAFQWSA-N |
| XLogP | 0.60 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|